C26H26BN2O2 — CID 145340823
CID 145340823 (PubChem CID 145340823) has the molecular formula C26H26BN2O2 and a molecular weight of 409.32 g/mol.
| Compound Name | CID 145340823 |
|---|---|
| PubChem CID | 145340823 |
| Molecular Formula | C26H26BN2O2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc(-c2cc(-c3ccccn3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H26BN2O2/c1-25(2,30)26(3,4)31-27-19-14-12-18(13-15-19)21-17-24(23-11-7-8-16-28-23)29-22-10-6-5-9-20(21)22/h5-17,30H,1-4H3 |
| InChIKey | QMRLSGZIGZXJCF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|