C42H37BNO3 — CID 140706912
CID 140706912 (PubChem CID 140706912) has the molecular formula C42H37BNO3 and a molecular weight of 614.57 g/mol.
| Compound Name | CID 140706912 |
|---|---|
| PubChem CID | 140706912 |
| Molecular Formula | C42H37BNO3 |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc4c(c3)oc3ccccc34)cc2)cc1 |
| InChI | InChI=1S/C42H37BNO3/c1-41(2,45)42(3,4)47-43-33-19-25-36(26-20-33)44(34-21-14-30(15-22-34)29-10-6-5-7-11-29)35-23-16-31(17-24-35)32-18-27-38-37-12-8-9-13-39(37)46-40(38)28-32/h5-28,45H,1-4H3 |
| InChIKey | PTPAZCDKCZGUKB-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|