About CID 174363159
CID 174363159 (PubChem CID 174363159) has the molecular formula C30H28BO3
and a molecular weight of 447.36 g/mol.
Molecular Properties
| Compound Name | CID 174363159 |
| PubChem CID | 174363159 |
| Molecular Formula | C30H28BO3 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc2oc3cc(-c4cccc(-c5ccccc5)c4)ccc3c2c1 |
| InChI | InChI=1S/C30H28BO3/c1-29(2,32)30(3,4)34-31-24-14-16-27-26(19-24)25-15-13-23(18-28(25)33-27)22-12-8-11-21(17-22)20-9-6-5-7-10-20/h5-19,32H,1-4H3 |
| InChIKey | WILHDEWANHGGOU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174363159 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174363159?
The IUPAC name of CID 174363159 (CID 174363159) is not available.
What is the SMILES notation for CID 174363159?
The canonical SMILES for CID 174363159 is CC(C)(O)C(C)(C)O[B]c1ccc2oc3cc(-c4cccc(-c5ccccc5)c4)ccc3c2c1.
What is the InChIKey of CID 174363159?
The InChIKey is WILHDEWANHGGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28BO3/c1-29(2,32)30(3,4)34-31-24-14-16-27-26(19-24)25-15-13-23(18-28(25)33-27)22-12-8-11-21(17-22)20-9-6-5-7-10-20/h5-19,32H,1-4H3.
What are the key properties of CID 174363159?
CID 174363159 has a molecular weight of 447.36 g/mol, XLogP of 6.73, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174363159 is sourced from PubChem (CID 174363159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).