C32H28BO3 — CID 152860476
CID 152860476 (PubChem CID 152860476) has the molecular formula C32H28BO3 and a molecular weight of 471.39 g/mol.
| Compound Name | CID 152860476 |
|---|---|
| PubChem CID | 152860476 |
| Molecular Formula | C32H28BO3 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1c2ccccc2c(-c2ccc3oc4ccccc4c3c2)c2ccccc12 |
| InChI | InChI=1S/C32H28BO3/c1-31(2,34)32(3,4)36-33-30-24-14-7-5-12-22(24)29(23-13-6-8-15-25(23)30)20-17-18-28-26(19-20)21-11-9-10-16-27(21)35-28/h5-19,34H,1-4H3 |
| InChIKey | LSPWYGZLEOJQQW-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|