C31H31N3O5 — CID 123330893
4a-hydroxy-3-methyl-7-oxo-N-[2-[4-(2-oxo-1H-pyridin-4-yl)phenyl]ethyl]-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide (PubChem CID 123330893) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 4a-hydroxy-3-methyl-7-oxo-N-[2-[4-(2-oxo-1H-pyridin-4-yl)phenyl]ethyl]-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide.
| Compound Name | 4a-hydroxy-3-methyl-7-oxo-N-[2-[4-(2-oxo-1H-pyridin-4-yl)phenyl]ethyl]-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 123330893 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 4a-hydroxy-3-methyl-7-oxo-N-[2-[4-(2-oxo-1H-pyridin-4-yl)phenyl]ethyl]-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
| SMILES | CN1CCC23c4c5ccc(C(=O)NCCc6ccc(-c7cc[nH]c(=O)c7)cc6)c4OC2C(=O)CCC3(O)C1C5 |
| InChI | InChI=1S/C31H31N3O5/c1-34-15-12-30-26-21-6-7-22(27(26)39-28(30)23(35)8-11-31(30,38)24(34)16-21)29(37)33-13-9-18-2-4-19(5-3-18)20-10-14-32-25(36)17-20/h2-7,10,14,17,24,28,38H,8-9,11-13,15-16H2,1H3,(H,32,36)(H,33,37) |
| InChIKey | QJFRQNNLIVEYGK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |