C26H27BrN2O4 — CID 71150012
(4R,4aS,7aR,12bS)-N-[2-(4-bromophenyl)ethyl]-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide (PubChem CID 71150012) has the molecular formula C26H27BrN2O4 and a molecular weight of 511.42 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-N-[2-(4-bromophenyl)ethyl]-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide.
| Compound Name | (4R,4aS,7aR,12bS)-N-[2-(4-bromophenyl)ethyl]-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 71150012 |
| Molecular Formula | C26H27BrN2O4 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | (4R,4aS,7aR,12bS)-N-[2-(4-bromophenyl)ethyl]-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
| SMILES | CN1CC[C@]23c4c5ccc(C(=O)NCCc6ccc(Br)cc6)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C26H27BrN2O4/c1-29-13-11-25-21-16-4-7-18(24(31)28-12-9-15-2-5-17(27)6-3-15)22(21)33-23(25)19(30)8-10-26(25,32)20(29)14-16/h2-7,20,23,32H,8-14H2,1H3,(H,28,31)/t20-,23+,25+,26-/m1/s1 |
| InChIKey | KUBKYVLDMDIADY-RTOPKKFASA-N |
| XLogP | 2.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |