C20H26F3N3O3 — CID 123331089
7-ethyl-3-methyl-2-oxo-N-[2-[[3-(trifluoromethyl)cyclohex-2-en-1-ylidene]amino]ethyl]-1-oxa-7-azaspiro[4.4]non-3-ene-4-carboxamide (PubChem CID 123331089) has the molecular formula C20H26F3N3O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 7-ethyl-3-methyl-2-oxo-N-[2-[[3-(trifluoromethyl)cyclohex-2-en-1-ylidene]amino]ethyl]-1-oxa-7-azaspiro[4.4]non-3-ene-4-carboxamide.
| Compound Name | 7-ethyl-3-methyl-2-oxo-N-[2-[[3-(trifluoromethyl)cyclohex-2-en-1-ylidene]amino]ethyl]-1-oxa-7-azaspiro[4.4]non-3-ene-4-carboxamide |
|---|---|
| PubChem CID | 123331089 |
| Molecular Formula | C20H26F3N3O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 7-ethyl-3-methyl-2-oxo-N-[2-[[3-(trifluoromethyl)cyclohex-2-en-1-ylidene]amino]ethyl]-1-oxa-7-azaspiro[4.4]non-3-ene-4-carboxamide |
| SMILES | CCN1CCC2(C1)OC(=O)C(C)=C2C(=O)NCC/N=C1/C=C(C(F)(F)F)CCC1 |
| InChI | InChI=1S/C20H26F3N3O3/c1-3-26-10-7-19(12-26)16(13(2)18(28)29-19)17(27)25-9-8-24-15-6-4-5-14(11-15)20(21,22)23/h11H,3-10,12H2,1-2H3,(H,25,27)/b24-15+ |
| InChIKey | PMZXFQUFXIWKFY-BUVRLJJBSA-N |
| XLogP | 2.55 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|