C16H27N3 — CID 123331297
(Z)-2-N-tert-butyl-7-N-ethylidene-4-N,3-dimethyl-5-methylidenehept-6-ene-2,4,7-triimine (PubChem CID 123331297) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (Z)-2-N-tert-butyl-7-N-ethylidene-4-N,3-dimethyl-5-methylidenehept-6-ene-2,4,7-triimine.
| Compound Name | (Z)-2-N-tert-butyl-7-N-ethylidene-4-N,3-dimethyl-5-methylidenehept-6-ene-2,4,7-triimine |
|---|---|
| PubChem CID | 123331297 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (Z)-2-N-tert-butyl-7-N-ethylidene-4-N,3-dimethyl-5-methylidenehept-6-ene-2,4,7-triimine |
| SMILES | C=C(/C=C\N=C\C)/C(=N\C)C(C)/C(C)=N/C(C)(C)C |
| InChI | InChI=1S/C16H27N3/c1-9-18-11-10-12(2)15(17-8)13(3)14(4)19-16(5,6)7/h9-11,13H,2H2,1,3-8H3/b11-10-,17-15+,18-9+,19-14+ |
| InChIKey | IZNSAGMILAXBJE-PKBAKLFDSA-N |
| XLogP | 4.11 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|