C19H33N3 — CID 143032041
1-(2,3-dihydropyridin-5-yl)-4-N-ethenyl-1-N,3-dimethylhex-5-ene-1,4-diimine;ethane (PubChem CID 143032041) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is 1-(2,3-dihydropyridin-5-yl)-4-N-ethenyl-1-N,3-dimethylhex-5-ene-1,4-diimine;ethane.
| Compound Name | 1-(2,3-dihydropyridin-5-yl)-4-N-ethenyl-1-N,3-dimethylhex-5-ene-1,4-diimine;ethane |
|---|---|
| PubChem CID | 143032041 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | 1-(2,3-dihydropyridin-5-yl)-4-N-ethenyl-1-N,3-dimethylhex-5-ene-1,4-diimine;ethane |
| SMILES | C=C/N=C(\C=C)C(C)C/C(=N\C)C1=CCCN=C1.CC.CC |
| InChI | InChI=1S/C15H21N3.2C2H6/c1-5-14(18-6-2)12(3)10-15(16-4)13-8-7-9-17-11-13;2*1-2/h5-6,8,11-12H,1-2,7,9-10H2,3-4H3;2*1-2H3/b16-15+,18-14+;; |
| InChIKey | WOCOARWTVDNLSW-ABDBWWMLSA-N |
| XLogP | 5.31 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|