C19H28N2 — CID 91016536
4-ethyl-N-(6-ethyl-4,5-dimethyl-2H-azepin-2-yl)-6-methylcyclohex-2-en-1-imine (PubChem CID 91016536) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 4-ethyl-N-(6-ethyl-4,5-dimethyl-2H-azepin-2-yl)-6-methylcyclohex-2-en-1-imine.
| Compound Name | 4-ethyl-N-(6-ethyl-4,5-dimethyl-2H-azepin-2-yl)-6-methylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 91016536 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 4-ethyl-N-(6-ethyl-4,5-dimethyl-2H-azepin-2-yl)-6-methylcyclohex-2-en-1-imine |
| SMILES | CCC1=C(C)C(C)=CC(N=C2C=CC(CC)CC2C)N=C1 |
| InChI | InChI=1S/C19H28N2/c1-6-16-8-9-18(14(4)10-16)21-19-11-13(3)15(5)17(7-2)12-20-19/h8-9,11-12,14,16,19H,6-7,10H2,1-5H3 |
| InChIKey | BQQGXKHZXQEUDI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|