C17H31N3 — CID 123432181
(Z)-6-N,3,4,9,10-pentamethyl-1-N-(methylideneamino)undec-7-ene-1,6-diimine (PubChem CID 123432181) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is (Z)-6-N,3,4,9,10-pentamethyl-1-N-(methylideneamino)undec-7-ene-1,6-diimine.
| Compound Name | (Z)-6-N,3,4,9,10-pentamethyl-1-N-(methylideneamino)undec-7-ene-1,6-diimine |
|---|---|
| PubChem CID | 123432181 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | (Z)-6-N,3,4,9,10-pentamethyl-1-N-(methylideneamino)undec-7-ene-1,6-diimine |
| SMILES | C=N/N=C/CC(C)C(C)CC(/C=C\C(C)C(C)C)=N\C |
| InChI | InChI=1S/C17H31N3/c1-13(2)14(3)8-9-17(18-6)12-16(5)15(4)10-11-20-19-7/h8-9,11,13-16H,7,10,12H2,1-6H3/b9-8-,18-17-,20-11+ |
| InChIKey | AYGFIKSWRLMNIE-IMJXTPBQSA-N |
| XLogP | 4.64 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|