C18H35N — CID 123523690
N-(10-ethyl-4,9-dimethyldodec-5-en-2-yl)ethanimine (PubChem CID 123523690) has the molecular formula C18H35N and a molecular weight of 265.49 g/mol. Its IUPAC name is N-(10-ethyl-4,9-dimethyldodec-5-en-2-yl)ethanimine.
| Compound Name | N-(10-ethyl-4,9-dimethyldodec-5-en-2-yl)ethanimine |
|---|---|
| PubChem CID | 123523690 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | N-(10-ethyl-4,9-dimethyldodec-5-en-2-yl)ethanimine |
| SMILES | C/C=N/C(C)CC(C)C=CCCC(C)C(CC)CC |
| InChI | InChI=1S/C18H35N/c1-7-18(8-2)16(5)13-11-10-12-15(4)14-17(6)19-9-3/h9-10,12,15-18H,7-8,11,13-14H2,1-6H3/b12-10?,19-9+ |
| InChIKey | PRKRZACVCOGHAW-CROFDNJQSA-N |
| XLogP | 5.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|