C32H62 — CID 90924363
15-ethyl-14,17-dimethyl-7-(3-methylhexan-2-yl)-13-propyloctadeca-2,8-diene (PubChem CID 90924363) has the molecular formula C32H62 and a molecular weight of 446.85 g/mol. Its IUPAC name is 15-ethyl-14,17-dimethyl-7-(3-methylhexan-2-yl)-13-propyloctadeca-2,8-diene.
| Compound Name | 15-ethyl-14,17-dimethyl-7-(3-methylhexan-2-yl)-13-propyloctadeca-2,8-diene |
|---|---|
| PubChem CID | 90924363 |
| Molecular Formula | C32H62 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.49 |
| IUPAC Name | 15-ethyl-14,17-dimethyl-7-(3-methylhexan-2-yl)-13-propyloctadeca-2,8-diene |
| SMILES | CC=CCCCC(C=CCCCC(CCC)C(C)C(CC)CC(C)C)C(C)C(C)CCC |
| InChI | InChI=1S/C32H62/c1-10-14-15-17-23-32(28(8)27(7)20-11-2)24-19-16-18-22-31(21-12-3)29(9)30(13-4)25-26(5)6/h10,14,19,24,26-32H,11-13,15-18,20-23,25H2,1-9H3 |
| InChIKey | AJCTWPJNTBYXFB-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|