C10H21N — CID 174038917
(Z,3R)-3-methylnon-7-en-1-amine (PubChem CID 174038917) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is (Z,3R)-3-methylnon-7-en-1-amine.
| Compound Name | (Z,3R)-3-methylnon-7-en-1-amine |
|---|---|
| PubChem CID | 174038917 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (Z,3R)-3-methylnon-7-en-1-amine |
| SMILES | C/C=C\CCC[C@@H](C)CCN |
| InChI | InChI=1S/C10H21N/c1-3-4-5-6-7-10(2)8-9-11/h3-4,10H,5-9,11H2,1-2H3/b4-3-/t10-/m1/s1 |
| InChIKey | NBHKZPUTSMDSHB-UMBAGQNISA-N |
| XLogP | 2.90 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | 97 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|