C14H29N — CID 142802272
(E,6R)-2,6-dimethyldodec-10-en-2-amine (PubChem CID 142802272) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is (E,6R)-2,6-dimethyldodec-10-en-2-amine.
| Compound Name | (E,6R)-2,6-dimethyldodec-10-en-2-amine |
|---|---|
| PubChem CID | 142802272 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | (E,6R)-2,6-dimethyldodec-10-en-2-amine |
| SMILES | C/C=C/CCC[C@@H](C)CCCC(C)(C)N |
| InChI | InChI=1S/C14H29N/c1-5-6-7-8-10-13(2)11-9-12-14(3,4)15/h5-6,13H,7-12,15H2,1-4H3/b6-5+/t13-/m1/s1 |
| InChIKey | KMNMJBIBOKSQLH-URWSZGRFSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|