C9H18O — CID 14091580
(E)-3-methyloct-6-en-1-ol (PubChem CID 14091580) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (E)-3-methyloct-6-en-1-ol.
| Compound Name | (E)-3-methyloct-6-en-1-ol |
|---|---|
| PubChem CID | 14091580 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (E)-3-methyloct-6-en-1-ol |
| SMILES | C/C=C/CCC(C)CCO |
| InChI | InChI=1S/C9H18O/c1-3-4-5-6-9(2)7-8-10/h3-4,9-10H,5-8H2,1-2H3/b4-3+ |
| InChIKey | ATNLQUNMECVMJZ-ONEGZZNKSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|