C10H19NO — CID 134553932
(Z)-8-imino-3-methylnon-6-en-1-ol (PubChem CID 134553932) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (Z)-8-imino-3-methylnon-6-en-1-ol.
| Compound Name | (Z)-8-imino-3-methylnon-6-en-1-ol |
|---|---|
| PubChem CID | 134553932 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (Z)-8-imino-3-methylnon-6-en-1-ol |
| SMILES | [H]/N=C(C)/C=C\CCC(C)CCO |
| InChI | InChI=1S/C10H19NO/c1-9(7-8-12)5-3-4-6-10(2)11/h4,6,9,11-12H,3,5,7-8H2,1-2H3/b6-4-,11-10+ |
| InChIKey | KIDMXDUAXKFGKP-NIRQPQSLSA-N |
| XLogP | 2.38 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|