C32H62 — CID 91569946
3,4,5,6,6,7,11,13-octamethyltetracosa-9,14-diene (PubChem CID 91569946) has the molecular formula C32H62 and a molecular weight of 446.85 g/mol. Its IUPAC name is 3,4,5,6,6,7,11,13-octamethyltetracosa-9,14-diene.
| Compound Name | 3,4,5,6,6,7,11,13-octamethyltetracosa-9,14-diene |
|---|---|
| PubChem CID | 91569946 |
| Molecular Formula | C32H62 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.49 |
| IUPAC Name | 3,4,5,6,6,7,11,13-octamethyltetracosa-9,14-diene |
| SMILES | CCCCCCCCCC=CC(C)CC(C)C=CCC(C)C(C)(C)C(C)C(C)C(C)CC |
| InChI | InChI=1S/C32H62/c1-11-13-14-15-16-17-18-19-20-22-26(3)25-27(4)23-21-24-29(6)32(9,10)31(8)30(7)28(5)12-2/h20-23,26-31H,11-19,24-25H2,1-10H3 |
| InChIKey | DSENJGHEDPYEFW-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|