C10H17N3 — CID 123693521
(Z)-2,3-dimethyl-1-N-(methylideneamino)hept-5-ene-1,4-diimine (PubChem CID 123693521) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (Z)-2,3-dimethyl-1-N-(methylideneamino)hept-5-ene-1,4-diimine.
| Compound Name | (Z)-2,3-dimethyl-1-N-(methylideneamino)hept-5-ene-1,4-diimine |
|---|---|
| PubChem CID | 123693521 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (Z)-2,3-dimethyl-1-N-(methylideneamino)hept-5-ene-1,4-diimine |
| SMILES | [H]/N=C(\C=C/C)C(C)C(C)/C=N/N=C |
| InChI | InChI=1S/C10H17N3/c1-5-6-10(11)9(3)8(2)7-13-12-4/h5-9,11H,4H2,1-3H3/b6-5-,11-10+,13-7+ |
| InChIKey | KISANTNRNKFYPE-VWRVOUOTSA-N |
| XLogP | 2.54 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|