C16H31N — CID 123456367
N-hex-4-en-3-yl-3-propylheptan-1-imine (PubChem CID 123456367) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is N-hex-4-en-3-yl-3-propylheptan-1-imine.
| Compound Name | N-hex-4-en-3-yl-3-propylheptan-1-imine |
|---|---|
| PubChem CID | 123456367 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | N-hex-4-en-3-yl-3-propylheptan-1-imine |
| SMILES | CC=CC(CC)/N=C/CC(CCC)CCCC |
| InChI | InChI=1S/C16H31N/c1-5-9-12-15(10-6-2)13-14-17-16(8-4)11-7-3/h7,11,14-16H,5-6,8-10,12-13H2,1-4H3/b11-7?,17-14+ |
| InChIKey | FAJCBSACGMRUQG-OSQBHXSNSA-N |
| XLogP | 5.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|