C20H23N3O3 — CID 123331512
1-N,3-N,5-N-trimethoxy-1,5-diphenylpenta-1,2,4-triene-1,3,5-triamine (PubChem CID 123331512) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-N,3-N,5-N-trimethoxy-1,5-diphenylpenta-1,2,4-triene-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-trimethoxy-1,5-diphenylpenta-1,2,4-triene-1,3,5-triamine |
|---|---|
| PubChem CID | 123331512 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-N,3-N,5-N-trimethoxy-1,5-diphenylpenta-1,2,4-triene-1,3,5-triamine |
| SMILES | CONC(=C=C(NOC)c1ccccc1)C=C(NOC)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O3/c1-24-21-18(14-19(22-25-2)16-10-6-4-7-11-16)15-20(23-26-3)17-12-8-5-9-13-17/h4-14,21-23H,1-3H3 |
| InChIKey | XDGSZIWXTOEOIF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|