C12H15N2O3+ — CID 57199456
methyl 4-(methoxyamino)-4-(1-methylpyridin-1-ium-3-yl)buta-2,3-dienoate (PubChem CID 57199456) has the molecular formula C12H15N2O3+ and a molecular weight of 235.26 g/mol. Its IUPAC name is methyl 4-(methoxyamino)-4-(1-methylpyridin-1-ium-3-yl)buta-2,3-dienoate.
| Compound Name | methyl 4-(methoxyamino)-4-(1-methylpyridin-1-ium-3-yl)buta-2,3-dienoate |
|---|---|
| PubChem CID | 57199456 |
| Molecular Formula | C12H15N2O3+ |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | methyl 4-(methoxyamino)-4-(1-methylpyridin-1-ium-3-yl)buta-2,3-dienoate |
| SMILES | CONC(=C=CC(=O)OC)c1ccc[n+](C)c1 |
| InChI | InChI=1S/C12H15N2O3/c1-14-8-4-5-10(9-14)11(13-17-3)6-7-12(15)16-2/h4-5,7-9,13H,1-3H3/q+1 |
| InChIKey | GPOWTJQJTBLAMO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|