C23H38O2 — CID 123331686
1-(3-ethyl-3-hydroxy-8,13-dimethyl-1,2,4,5,6,7,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 123331686) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 1-(3-ethyl-3-hydroxy-8,13-dimethyl-1,2,4,5,6,7,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 1-(3-ethyl-3-hydroxy-8,13-dimethyl-1,2,4,5,6,7,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 123331686 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 1-(3-ethyl-3-hydroxy-8,13-dimethyl-1,2,4,5,6,7,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CCC1(O)CCC2C(CCC3(C)C2CCC2(C)C(C(C)=O)CCC23)C1 |
| InChI | InChI=1S/C23H38O2/c1-5-23(25)13-9-17-16(14-23)8-11-22(4)19(17)10-12-21(3)18(15(2)24)6-7-20(21)22/h16-20,25H,5-14H2,1-4H3 |
| InChIKey | DZRYGGFOZIBCCH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |