C28H43N3O2 — CID 163412243
2-[2-[(1S,2R,5S,9S,10R,13R,15R)-15-ethyl-15-hydroxy-5,10-dimethyl-6-tetracyclo[11.4.1.02,10.05,9]octadecanyl]-2-oxoethyl]-3,4-dihydropyrazole-4-carbonitrile (PubChem CID 163412243) has the molecular formula C28H43N3O2 and a molecular weight of 453.67 g/mol. Its IUPAC name is 2-[2-[(1S,2R,5S,9S,10R,13R,15R)-15-ethyl-15-hydroxy-5,10-dimethyl-6-tetracyclo[11.4.1.02,10.05,9]octadecanyl]-2-oxoethyl]-3,4-dihydropyrazole-4-carbonitrile.
| Compound Name | 2-[2-[(1S,2R,5S,9S,10R,13R,15R)-15-ethyl-15-hydroxy-5,10-dimethyl-6-tetracyclo[11.4.1.02,10.05,9]octadecanyl]-2-oxoethyl]-3,4-dihydropyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 163412243 |
| Molecular Formula | C28H43N3O2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | 2-[2-[(1S,2R,5S,9S,10R,13R,15R)-15-ethyl-15-hydroxy-5,10-dimethyl-6-tetracyclo[11.4.1.02,10.05,9]octadecanyl]-2-oxoethyl]-3,4-dihydropyrazole-4-carbonitrile |
| SMILES | CC[C@@]1(O)CC[C@H]2C[C@@H](CC[C@]3(C)[C@@H]2CC[C@]2(C)C(C(=O)CN4CC(C#N)C=N4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H43N3O2/c1-4-28(33)12-8-21-13-19(14-28)7-10-26(2)22(21)9-11-27(3)23(5-6-25(26)27)24(32)18-31-17-20(15-29)16-30-31/h16,19-23,25,33H,4-14,17-18H2,1-3H3/t19-,20?,21+,22-,23?,25+,26-,27-,28-/m1/s1 |
| InChIKey | ABMAVXRTZAUZQN-ZAHDKTQLSA-N |
| XLogP | 5.19 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |