C26H46N2O4S — CID 123899007
1-[5-(2-ethyl-4-hydroxy-4-methylcyclohexyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 123899007) has the molecular formula C26H46N2O4S and a molecular weight of 482.73 g/mol. Its IUPAC name is 1-[5-(2-ethyl-4-hydroxy-4-methylcyclohexyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 1-[5-(2-ethyl-4-hydroxy-4-methylcyclohexyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 123899007 |
| Molecular Formula | C26H46N2O4S |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | 1-[5-(2-ethyl-4-hydroxy-4-methylcyclohexyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CCC1CC(C)(O)CCC1C1CCC2(C)C(CCC2C(=O)CN2CCN(S(C)(=O)=O)CC2)C1 |
| InChI | InChI=1S/C26H46N2O4S/c1-5-19-17-25(2,30)10-9-22(19)20-8-11-26(3)21(16-20)6-7-23(26)24(29)18-27-12-14-28(15-13-27)33(4,31)32/h19-23,30H,5-18H2,1-4H3 |
| InChIKey | SDRSNYNMNPCYBO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |