C30H16O2 — CID 123332779
6,7-bis(ethenyl)heptacyclo[20.3.1.02,11.04,9.012,25.015,24.018,23]hexacosa-1(26),2,4(9),6,10,12(25),13,15(24),16,18(23),19,21-dodecaene-5,8-dione (PubChem CID 123332779) has the molecular formula C30H16O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 6,7-bis(ethenyl)heptacyclo[20.3.1.02,11.04,9.012,25.015,24.018,23]hexacosa-1(26),2,4(9),6,10,12(25),13,15(24),16,18(23),19,21-dodecaene-5,8-dione.
| Compound Name | 6,7-bis(ethenyl)heptacyclo[20.3.1.02,11.04,9.012,25.015,24.018,23]hexacosa-1(26),2,4(9),6,10,12(25),13,15(24),16,18(23),19,21-dodecaene-5,8-dione |
|---|---|
| PubChem CID | 123332779 |
| Molecular Formula | C30H16O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 6,7-bis(ethenyl)heptacyclo[20.3.1.02,11.04,9.012,25.015,24.018,23]hexacosa-1(26),2,4(9),6,10,12(25),13,15(24),16,18(23),19,21-dodecaene-5,8-dione |
| SMILES | C=CC1=C(C=C)C(=O)c2cc3c(cc2C1=O)-c1ccc2ccc4cccc5cc-3c1c2c45 |
| InChI | InChI=1S/C30H16O2/c1-3-18-19(4-2)30(32)25-14-22-21(13-24(25)29(18)31)20-11-10-16-9-8-15-6-5-7-17-12-23(22)28(20)27(16)26(15)17/h3-14H,1-2H2 |
| InChIKey | ZWHVLMKKANPGGF-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|