C23H31F2N3O3 — CID 123333418
2-(2,2-difluoroethyl)-4'-ethyl-8a-hydroxy-4a-(5-hydroxy-2-methylphenyl)-1-methylspiro[1,3,4,5,7,8-hexahydroisoquinoline-6,5'-1H-imidazole]-2'-one (PubChem CID 123333418) has the molecular formula C23H31F2N3O3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-4'-ethyl-8a-hydroxy-4a-(5-hydroxy-2-methylphenyl)-1-methylspiro[1,3,4,5,7,8-hexahydroisoquinoline-6,5'-1H-imidazole]-2'-one.
| Compound Name | 2-(2,2-difluoroethyl)-4'-ethyl-8a-hydroxy-4a-(5-hydroxy-2-methylphenyl)-1-methylspiro[1,3,4,5,7,8-hexahydroisoquinoline-6,5'-1H-imidazole]-2'-one |
|---|---|
| PubChem CID | 123333418 |
| Molecular Formula | C23H31F2N3O3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-(2,2-difluoroethyl)-4'-ethyl-8a-hydroxy-4a-(5-hydroxy-2-methylphenyl)-1-methylspiro[1,3,4,5,7,8-hexahydroisoquinoline-6,5'-1H-imidazole]-2'-one |
| SMILES | CCC1=NC(=O)NC12CCC1(O)C(C)N(CC(F)F)CCC1(c1cc(O)ccc1C)C2 |
| InChI | InChI=1S/C23H31F2N3O3/c1-4-18-22(27-20(30)26-18)7-8-23(31)15(3)28(12-19(24)25)10-9-21(23,13-22)17-11-16(29)6-5-14(17)2/h5-6,11,15,19,29,31H,4,7-10,12-13H2,1-3H3,(H,27,30) |
| InChIKey | URFXTZXYPUZDEZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |