C21H32OS — CID 123333858
4-ethenyl-10-hepta-2,4-dien-4-ylsulfanyldodeca-2,6,8-trien-1-ol (PubChem CID 123333858) has the molecular formula C21H32OS and a molecular weight of 332.55 g/mol. Its IUPAC name is 4-ethenyl-10-hepta-2,4-dien-4-ylsulfanyldodeca-2,6,8-trien-1-ol.
| Compound Name | 4-ethenyl-10-hepta-2,4-dien-4-ylsulfanyldodeca-2,6,8-trien-1-ol |
|---|---|
| PubChem CID | 123333858 |
| Molecular Formula | C21H32OS |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 4-ethenyl-10-hepta-2,4-dien-4-ylsulfanyldodeca-2,6,8-trien-1-ol |
| SMILES | C=CC(C=CCO)CC=CC=CC(CC)SC(C=CC)=CCC |
| InChI | InChI=1S/C21H32OS/c1-5-13-21(14-6-2)23-20(8-4)17-11-9-10-15-19(7-3)16-12-18-22/h5,7,9-14,16-17,19-20,22H,3,6,8,15,18H2,1-2,4H3 |
| InChIKey | AAUYSROOBVMTBZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|