C8H14N2 — CID 123334114
N-methyl-3-methylidene-5-(methylideneamino)pent-4-en-1-amine (PubChem CID 123334114) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N-methyl-3-methylidene-5-(methylideneamino)pent-4-en-1-amine.
| Compound Name | N-methyl-3-methylidene-5-(methylideneamino)pent-4-en-1-amine |
|---|---|
| PubChem CID | 123334114 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-methyl-3-methylidene-5-(methylideneamino)pent-4-en-1-amine |
| SMILES | C=NC=CC(=C)CCNC |
| InChI | InChI=1S/C8H14N2/c1-8(4-6-9-2)5-7-10-3/h4,6,10H,1-2,5,7H2,3H3 |
| InChIKey | RWRSEMNAGAYORR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|