C7H14N2 — CID 143076732
(Z)-2-ethenyl-N-methylbut-1-ene-1,4-diamine (PubChem CID 143076732) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (Z)-2-ethenyl-N-methylbut-1-ene-1,4-diamine.
| Compound Name | (Z)-2-ethenyl-N-methylbut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 143076732 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (Z)-2-ethenyl-N-methylbut-1-ene-1,4-diamine |
| SMILES | C=C/C(=C\NC)CCN |
| InChI | InChI=1S/C7H14N2/c1-3-7(4-5-8)6-9-2/h3,6,9H,1,4-5,8H2,2H3/b7-6+ |
| InChIKey | OLTHBQIXMWSCOO-VOTSOKGWSA-N |
| XLogP | 0.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|