C22H43N7O — CID 123334449
2-(4-methylpiperazin-1-yl)-3-piperazin-1-yl-3-piperidin-1-yl-2-pyrrolidin-1-ylmorpholine (PubChem CID 123334449) has the molecular formula C22H43N7O and a molecular weight of 421.63 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-3-piperazin-1-yl-3-piperidin-1-yl-2-pyrrolidin-1-ylmorpholine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-3-piperazin-1-yl-3-piperidin-1-yl-2-pyrrolidin-1-ylmorpholine |
|---|---|
| PubChem CID | 123334449 |
| Molecular Formula | C22H43N7O |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.35 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-3-piperazin-1-yl-3-piperidin-1-yl-2-pyrrolidin-1-ylmorpholine |
| SMILES | CN1CCN(C2(N3CCCC3)OCCNC2(N2CCCCC2)N2CCNCC2)CC1 |
| InChI | InChI=1S/C22H43N7O/c1-25-16-18-29(19-17-25)22(28-12-5-6-13-28)21(24-9-20-30-22,26-10-3-2-4-11-26)27-14-7-23-8-15-27/h23-24H,2-20H2,1H3 |
| InChIKey | IZLUZJYESPCPCC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |