About 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine
2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine (PubChem CID 123334633) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine.
Analyze 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine?
The IUPAC name of 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine (CID 123334633) is 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine.
What is the SMILES notation for 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine?
The canonical SMILES for 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine is CCC1(C)C(C)C1NC(C)C.
What is the InChIKey of 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine?
The InChIKey is ADSXELUNUXOVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-6-10(5)8(4)9(10)11-7(2)3/h7-9,11H,6H2,1-5H3.
What are the key properties of 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine?
2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine has a molecular weight of 155.28 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,3-dimethyl-N-propan-2-ylcyclopropan-1-amine is sourced from PubChem (CID 123334633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).