C9H9BrN4 — CID 123335634
3-[5-(2-bromoethyl)-1H-1,2,4-triazol-3-yl]pyridine (PubChem CID 123335634) has the molecular formula C9H9BrN4 and a molecular weight of 253.10 g/mol. Its IUPAC name is 3-[5-(2-bromoethyl)-1H-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[5-(2-bromoethyl)-1H-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 123335634 |
| Molecular Formula | C9H9BrN4 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 3-[5-(2-bromoethyl)-1H-1,2,4-triazol-3-yl]pyridine |
| SMILES | BrCCc1nc(-c2cccnc2)n[nH]1 |
| InChI | InChI=1S/C9H9BrN4/c10-4-3-8-12-9(14-13-8)7-2-1-5-11-6-7/h1-2,5-6H,3-4H2,(H,12,13,14) |
| InChIKey | DRFDXKBISONMLJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|