C15H18ClN7 — CID 131918014
N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 131918014) has the molecular formula C15H18ClN7 and a molecular weight of 331.81 g/mol. Its IUPAC name is N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 131918014 |
| Molecular Formula | C15H18ClN7 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | Cc1nn(C)c(Cl)c1CNCCc1nc(-c2cccnc2)n[nH]1 |
| InChI | InChI=1S/C15H18ClN7/c1-10-12(14(16)23(2)22-10)9-18-7-5-13-19-15(21-20-13)11-4-3-6-17-8-11/h3-4,6,8,18H,5,7,9H2,1-2H3,(H,19,20,21) |
| InChIKey | MRSQEMUPODJTSK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|