C21H24N6O — CID 50977494
1-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-[2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethylamino]ethanone (PubChem CID 50977494) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-[2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethylamino]ethanone.
| Compound Name | 1-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-[2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethylamino]ethanone |
|---|---|
| PubChem CID | 50977494 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-[2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)ethylamino]ethanone |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)CNCCc1nc(-c2cccnc2)n[nH]1 |
| InChI | InChI=1S/C21H24N6O/c1-15-6-7-18-16(12-15)5-3-11-27(18)20(28)14-23-10-8-19-24-21(26-25-19)17-4-2-9-22-13-17/h2,4,6-7,9,12-13,23H,3,5,8,10-11,14H2,1H3,(H,24,25,26) |
| InChIKey | CLDXNSMLJXEVCJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|