C12H15N — CID 123336517
(5Z)-2,9,10,10a-tetrahydro-1H-benzo[8]annulen-3-imine (PubChem CID 123336517) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (5Z)-2,9,10,10a-tetrahydro-1H-benzo[8]annulen-3-imine.
| Compound Name | (5Z)-2,9,10,10a-tetrahydro-1H-benzo[8]annulen-3-imine |
|---|---|
| PubChem CID | 123336517 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (5Z)-2,9,10,10a-tetrahydro-1H-benzo[8]annulen-3-imine |
| SMILES | [H]/N=C1/C=C2/C=C\C=CCCC2CC1 |
| InChI | InChI=1S/C12H15N/c13-12-8-7-10-5-3-1-2-4-6-11(10)9-12/h1-2,4,6,9-10,13H,3,5,7-8H2/b2-1?,6-4-,13-12+ |
| InChIKey | BXFWQPSKECHPNF-ILLIJQKLSA-N |
| XLogP | 3.25 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|