C9H18N2OS — CID 123337041
(9-methyl-1-oxa-4,9-diazaspiro[4.5]decan-4-yl)methanethiol (PubChem CID 123337041) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is (9-methyl-1-oxa-4,9-diazaspiro[4.5]decan-4-yl)methanethiol.
| Compound Name | (9-methyl-1-oxa-4,9-diazaspiro[4.5]decan-4-yl)methanethiol |
|---|---|
| PubChem CID | 123337041 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (9-methyl-1-oxa-4,9-diazaspiro[4.5]decan-4-yl)methanethiol |
| SMILES | CN1CCCC2(C1)OCCN2CS |
| InChI | InChI=1S/C9H18N2OS/c1-10-4-2-3-9(7-10)11(8-13)5-6-12-9/h13H,2-8H2,1H3 |
| InChIKey | HGIFAYRSMNMQII-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|