C13H26FNS2 — CID 123337384
2-fluoro-N,3,5-trimethyl-7,8-bis(methylsulfanyl)oct-4-en-1-amine (PubChem CID 123337384) has the molecular formula C13H26FNS2 and a molecular weight of 279.49 g/mol. Its IUPAC name is 2-fluoro-N,3,5-trimethyl-7,8-bis(methylsulfanyl)oct-4-en-1-amine.
| Compound Name | 2-fluoro-N,3,5-trimethyl-7,8-bis(methylsulfanyl)oct-4-en-1-amine |
|---|---|
| PubChem CID | 123337384 |
| Molecular Formula | C13H26FNS2 |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-fluoro-N,3,5-trimethyl-7,8-bis(methylsulfanyl)oct-4-en-1-amine |
| SMILES | CNCC(F)C(C)C=C(C)CC(CSC)SC |
| InChI | InChI=1S/C13H26FNS2/c1-10(7-12(17-5)9-16-4)6-11(2)13(14)8-15-3/h6,11-13,15H,7-9H2,1-5H3 |
| InChIKey | GYICFDXDVBZGFC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|