C10H21NS — CID 163582264
(E,1S,2S,3S)-N,2,3-trimethyl-1-methylsulfanylhex-4-en-1-amine (PubChem CID 163582264) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is (E,1S,2S,3S)-N,2,3-trimethyl-1-methylsulfanylhex-4-en-1-amine.
| Compound Name | (E,1S,2S,3S)-N,2,3-trimethyl-1-methylsulfanylhex-4-en-1-amine |
|---|---|
| PubChem CID | 163582264 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (E,1S,2S,3S)-N,2,3-trimethyl-1-methylsulfanylhex-4-en-1-amine |
| SMILES | C/C=C/[C@H](C)[C@H](C)[C@@H](NC)SC |
| InChI | InChI=1S/C10H21NS/c1-6-7-8(2)9(3)10(11-4)12-5/h6-11H,1-5H3/b7-6+/t8-,9-,10-/m0/s1 |
| InChIKey | GINVFRBNWPDEKK-WQPYABEOSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|