C10H19NS — CID 123460923
6-ethyl-6-methyl-7-methylsulfanyl-1,2,3,7-tetrahydroazepine (PubChem CID 123460923) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 6-ethyl-6-methyl-7-methylsulfanyl-1,2,3,7-tetrahydroazepine.
| Compound Name | 6-ethyl-6-methyl-7-methylsulfanyl-1,2,3,7-tetrahydroazepine |
|---|---|
| PubChem CID | 123460923 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 6-ethyl-6-methyl-7-methylsulfanyl-1,2,3,7-tetrahydroazepine |
| SMILES | CCC1(C)C=CCCNC1SC |
| InChI | InChI=1S/C10H19NS/c1-4-10(2)7-5-6-8-11-9(10)12-3/h5,7,9,11H,4,6,8H2,1-3H3 |
| InChIKey | IECNEBHXXJEPMQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|