C31H35F4NO3 — CID 123337654
8-acetyl-6-[(3,5-difluorophenyl)methyl]-12,19-difluoro-11-hydroxy-2,9,13-trimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 123337654) has the molecular formula C31H35F4NO3 and a molecular weight of 545.62 g/mol. Its IUPAC name is 8-acetyl-6-[(3,5-difluorophenyl)methyl]-12,19-difluoro-11-hydroxy-2,9,13-trimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | 8-acetyl-6-[(3,5-difluorophenyl)methyl]-12,19-difluoro-11-hydroxy-2,9,13-trimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 123337654 |
| Molecular Formula | C31H35F4NO3 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 8-acetyl-6-[(3,5-difluorophenyl)methyl]-12,19-difluoro-11-hydroxy-2,9,13-trimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CC(=O)C12CN(Cc3cc(F)cc(F)c3)CC1CC1(C)C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
| InChI | InChI=1S/C31H35F4NO3/c1-17(37)30-16-36(14-18-7-20(32)9-21(33)8-18)15-19(30)12-28(3)25-11-24(34)23-10-22(38)5-6-27(23,2)31(25,35)26(39)13-29(28,30)4/h5-10,19,24-26,39H,11-16H2,1-4H3 |
| InChIKey | LNAJTKBFELPEPJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |