About [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine
[3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine (PubChem CID 123338138) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine.
Molecular Properties
| Compound Name | [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine |
| PubChem CID | 123338138 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine |
| SMILES | C=S(C)C1=CC(CN)CC1 |
| InChI | InChI=1S/C8H15NS/c1-10(2)8-4-3-7(5-8)6-9/h5,7H,1,3-4,6,9H2,2H3 |
| InChIKey | ZPXYAAMVGOLBJM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine?
The IUPAC name of [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine (CID 123338138) is [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine.
What is the SMILES notation for [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine?
The canonical SMILES for [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine is C=S(C)C1=CC(CN)CC1.
What is the InChIKey of [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine?
The InChIKey is ZPXYAAMVGOLBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-10(2)8-4-3-7(5-8)6-9/h5,7H,1,3-4,6,9H2,2H3.
What are the key properties of [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine?
[3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine has a molecular weight of 157.28 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[methyl(methylidene)-λ4-sulfanyl]cyclopent-2-en-1-yl]methanamine is sourced from PubChem (CID 123338138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).