About 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine
2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine (PubChem CID 170868968) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine.
Analyze 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine?
The IUPAC name of 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine (CID 170868968) is 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine.
What is the SMILES notation for 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine?
The canonical SMILES for 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine is CC1=CC(CCN)C(C)S1.
What is the InChIKey of 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine?
The InChIKey is LGSULVQKGJDMAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-6-5-8(3-4-9)7(2)10-6/h5,7-8H,3-4,9H2,1-2H3.
What are the key properties of 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine?
2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine has a molecular weight of 157.28 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)ethanamine is sourced from PubChem (CID 170868968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).