C14H25NS — CID 91333753
3-(5-butylsulfanylcyclohexa-1,5-dien-1-yl)butan-1-amine (PubChem CID 91333753) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 3-(5-butylsulfanylcyclohexa-1,5-dien-1-yl)butan-1-amine.
| Compound Name | 3-(5-butylsulfanylcyclohexa-1,5-dien-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 91333753 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-(5-butylsulfanylcyclohexa-1,5-dien-1-yl)butan-1-amine |
| SMILES | CCCCSC1=CC(C(C)CCN)=CCC1 |
| InChI | InChI=1S/C14H25NS/c1-3-4-10-16-14-7-5-6-13(11-14)12(2)8-9-15/h6,11-12H,3-5,7-10,15H2,1-2H3 |
| InChIKey | YVWBHGFDBCQUNF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|