C10H17NS — CID 142068147
2-[(4-methylcyclohexa-1,3-dien-1-yl)methylsulfanyl]ethanamine (PubChem CID 142068147) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is 2-[(4-methylcyclohexa-1,3-dien-1-yl)methylsulfanyl]ethanamine.
| Compound Name | 2-[(4-methylcyclohexa-1,3-dien-1-yl)methylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 142068147 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-[(4-methylcyclohexa-1,3-dien-1-yl)methylsulfanyl]ethanamine |
| SMILES | CC1=CC=C(CSCCN)CC1 |
| InChI | InChI=1S/C10H17NS/c1-9-2-4-10(5-3-9)8-12-7-6-11/h2,4H,3,5-8,11H2,1H3 |
| InChIKey | LIMWNCUKUKOAKY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|