C12H23NS — CID 54347198
2-(3,7-dimethylocta-2,6-dienylsulfanyl)ethanamine (PubChem CID 54347198) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienylsulfanyl)ethanamine.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 54347198 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienylsulfanyl)ethanamine |
| SMILES | CC(C)=CCCC(C)=CCSCCN |
| InChI | InChI=1S/C12H23NS/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h5,7H,4,6,8-10,13H2,1-3H3 |
| InChIKey | UDCXCOAMUHQEJL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|