C9H19NS — CID 58684137
3-(4-methylpent-3-enylsulfanyl)propan-1-amine (PubChem CID 58684137) has the molecular formula C9H19NS and a molecular weight of 173.33 g/mol. Its IUPAC name is 3-(4-methylpent-3-enylsulfanyl)propan-1-amine.
| Compound Name | 3-(4-methylpent-3-enylsulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 58684137 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.33 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-(4-methylpent-3-enylsulfanyl)propan-1-amine |
| SMILES | CC(C)=CCCSCCCN |
| InChI | InChI=1S/C9H19NS/c1-9(2)5-3-7-11-8-4-6-10/h5H,3-4,6-8,10H2,1-2H3 |
| InChIKey | SLHBRPNGORIPHX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|