C17H28N2O2S — CID 123338666
[4-(cyclohexylmethyl)-5-methyl-1,3-thiazol-2-yl]-(oxan-4-ylamino)methanol (PubChem CID 123338666) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is [4-(cyclohexylmethyl)-5-methyl-1,3-thiazol-2-yl]-(oxan-4-ylamino)methanol.
| Compound Name | [4-(cyclohexylmethyl)-5-methyl-1,3-thiazol-2-yl]-(oxan-4-ylamino)methanol |
|---|---|
| PubChem CID | 123338666 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [4-(cyclohexylmethyl)-5-methyl-1,3-thiazol-2-yl]-(oxan-4-ylamino)methanol |
| SMILES | Cc1sc(C(O)NC2CCOCC2)nc1CC1CCCCC1 |
| InChI | InChI=1S/C17H28N2O2S/c1-12-15(11-13-5-3-2-4-6-13)19-17(22-12)16(20)18-14-7-9-21-10-8-14/h13-14,16,18,20H,2-11H2,1H3 |
| InChIKey | FVWCLPHYDBFXQN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|