C11H17NO2S — CID 116867651
1-[5-methyl-4-(oxan-4-yl)-1,3-thiazol-2-yl]ethanol (PubChem CID 116867651) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-[5-methyl-4-(oxan-4-yl)-1,3-thiazol-2-yl]ethanol.
| Compound Name | 1-[5-methyl-4-(oxan-4-yl)-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 116867651 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-[5-methyl-4-(oxan-4-yl)-1,3-thiazol-2-yl]ethanol |
| SMILES | Cc1sc(C(C)O)nc1C1CCOCC1 |
| InChI | InChI=1S/C11H17NO2S/c1-7(13)11-12-10(8(2)15-11)9-3-5-14-6-4-9/h7,9,13H,3-6H2,1-2H3 |
| InChIKey | RHKXSRZRQRGAAX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |