C29H33N5O — CID 123338852
[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]-3-methylphenyl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 123338852) has the molecular formula C29H33N5O and a molecular weight of 467.62 g/mol. Its IUPAC name is [4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]-3-methylphenyl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]-3-methylphenyl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 123338852 |
| Molecular Formula | C29H33N5O |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | [4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]-3-methylphenyl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2ccc(CCc3ccnc4c(N)nc5cc(C)ccc5c34)c(C)c2)CC1 |
| InChI | InChI=1S/C29H33N5O/c1-4-33-13-15-34(16-14-33)29(35)23-9-7-21(20(3)18-23)6-8-22-11-12-31-27-26(22)24-10-5-19(2)17-25(24)32-28(27)30/h5,7,9-12,17-18H,4,6,8,13-16H2,1-3H3,(H2,30,32) |
| InChIKey | NVVAFWGYRREGSY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|